C18H22F3N3O2 — CID 136546576
1-cyclohexyl-5-oxo-N-[[2-(trifluoromethyl)-4-pyridinyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 136546576) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-cyclohexyl-5-oxo-N-[[2-(trifluoromethyl)-4-pyridinyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-cyclohexyl-5-oxo-N-[[2-(trifluoromethyl)-4-pyridinyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 136546576 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-cyclohexyl-5-oxo-N-[[2-(trifluoromethyl)-4-pyridinyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccnc(C(F)(F)F)c1)C1CC(=O)N(C2CCCCC2)C1 |
| InChI | InChI=1S/C18H22F3N3O2/c19-18(20,21)15-8-12(6-7-22-15)10-23-17(26)13-9-16(25)24(11-13)14-4-2-1-3-5-14/h6-8,13-14H,1-5,9-11H2,(H,23,26) |
| InChIKey | JUFJBQSPZRTNER-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |