C17H20FN5O2 — CID 136547293
3-fluoro-4-[4-[2-(4-methyl-2,5-dioxoimidazolidin-1-yl)ethyl]piperazin-1-yl]benzonitrile (PubChem CID 136547293) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is 3-fluoro-4-[4-[2-(4-methyl-2,5-dioxoimidazolidin-1-yl)ethyl]piperazin-1-yl]benzonitrile.
| Compound Name | 3-fluoro-4-[4-[2-(4-methyl-2,5-dioxoimidazolidin-1-yl)ethyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 136547293 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-fluoro-4-[4-[2-(4-methyl-2,5-dioxoimidazolidin-1-yl)ethyl]piperazin-1-yl]benzonitrile |
| SMILES | CC1NC(=O)N(CCN2CCN(c3ccc(C#N)cc3F)CC2)C1=O |
| InChI | InChI=1S/C17H20FN5O2/c1-12-16(24)23(17(25)20-12)9-6-21-4-7-22(8-5-21)15-3-2-13(11-19)10-14(15)18/h2-3,10,12H,4-9H2,1H3,(H,20,25) |
| InChIKey | GCVOMPSTYOVYLB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|