C15H27F2NO3S — CID 136548377
2-[1-[(2,2-difluorocyclohexyl)methylsulfonyl]azepan-4-yl]ethanol (PubChem CID 136548377) has the molecular formula C15H27F2NO3S and a molecular weight of 339.45 g/mol. Its IUPAC name is 2-[1-[(2,2-difluorocyclohexyl)methylsulfonyl]azepan-4-yl]ethanol.
| Compound Name | 2-[1-[(2,2-difluorocyclohexyl)methylsulfonyl]azepan-4-yl]ethanol |
|---|---|
| PubChem CID | 136548377 |
| Molecular Formula | C15H27F2NO3S |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-[1-[(2,2-difluorocyclohexyl)methylsulfonyl]azepan-4-yl]ethanol |
| SMILES | O=S(=O)(CC1CCCCC1(F)F)N1CCCC(CCO)CC1 |
| InChI | InChI=1S/C15H27F2NO3S/c16-15(17)8-2-1-5-14(15)12-22(20,21)18-9-3-4-13(6-10-18)7-11-19/h13-14,19H,1-12H2 |
| InChIKey | SOCXVJVKFYSRBX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |