C21H27N5O2 — CID 136548990
N-[[1-(4-methoxyphenyl)triazol-4-yl]methyl]-3-propan-2-yl-2-azaspiro[3.4]oct-6-ene-2-carboxamide (PubChem CID 136548990) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[[1-(4-methoxyphenyl)triazol-4-yl]methyl]-3-propan-2-yl-2-azaspiro[3.4]oct-6-ene-2-carboxamide.
| Compound Name | N-[[1-(4-methoxyphenyl)triazol-4-yl]methyl]-3-propan-2-yl-2-azaspiro[3.4]oct-6-ene-2-carboxamide |
|---|---|
| PubChem CID | 136548990 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[[1-(4-methoxyphenyl)triazol-4-yl]methyl]-3-propan-2-yl-2-azaspiro[3.4]oct-6-ene-2-carboxamide |
| SMILES | COc1ccc(-n2cc(CNC(=O)N3CC4(CC=CC4)C3C(C)C)nn2)cc1 |
| InChI | InChI=1S/C21H27N5O2/c1-15(2)19-21(10-4-5-11-21)14-25(19)20(27)22-12-16-13-26(24-23-16)17-6-8-18(28-3)9-7-17/h4-9,13,15,19H,10-12,14H2,1-3H3,(H,22,27) |
| InChIKey | HBWILQAEAHNCLL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|