C15H19N3O2 — CID 136551563
3-[1-(2,3-dimethylphenoxy)ethyl]-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine (PubChem CID 136551563) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[1-(2,3-dimethylphenoxy)ethyl]-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine.
| Compound Name | 3-[1-(2,3-dimethylphenoxy)ethyl]-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine |
|---|---|
| PubChem CID | 136551563 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-[1-(2,3-dimethylphenoxy)ethyl]-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine |
| SMILES | Cc1cccc(OC(C)c2nnc3n2CCOC3)c1C |
| InChI | InChI=1S/C15H19N3O2/c1-10-5-4-6-13(11(10)2)20-12(3)15-17-16-14-9-19-8-7-18(14)15/h4-6,12H,7-9H2,1-3H3 |
| InChIKey | USEAPOMRFPTQRM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |