About 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one
1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136551865) has the molecular formula C13H22N6O
and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 136551865 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCC(CC)NCCNc1nc2c(cnn2C)c(=O)[nH]1 |
| InChI | InChI=1S/C13H22N6O/c1-4-9(5-2)14-6-7-15-13-17-11-10(12(20)18-13)8-16-19(11)3/h8-9,14H,4-7H2,1-3H3,(H2,15,17,18,20) |
| InChIKey | YLPMXYHCPCTDLO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 136551865) is 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one is CCC(CC)NCCNc1nc2c(cnn2C)c(=O)[nH]1.
What is the InChIKey of 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is YLPMXYHCPCTDLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N6O/c1-4-9(5-2)14-6-7-15-13-17-11-10(12(20)18-13)8-16-19(11)3/h8-9,14H,4-7H2,1-3H3,(H2,15,17,18,20).
What are the key properties of 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 278.36 g/mol, XLogP of 0.85, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-[2-(pentan-3-ylamino)ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 136551865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).