C15H16ClN3O4 — CID 136552023
2-[4-[[(4-chloro-1-methylpyrazole-5-carbonyl)-methylamino]methyl]phenoxy]acetic acid (PubChem CID 136552023) has the molecular formula C15H16ClN3O4 and a molecular weight of 337.76 g/mol. Its IUPAC name is 2-[4-[[(4-chloro-1-methylpyrazole-5-carbonyl)-methylamino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[(4-chloro-1-methylpyrazole-5-carbonyl)-methylamino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 136552023 |
| Molecular Formula | C15H16ClN3O4 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-[4-[[(4-chloro-1-methylpyrazole-5-carbonyl)-methylamino]methyl]phenoxy]acetic acid |
| SMILES | CN(Cc1ccc(OCC(=O)O)cc1)C(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C15H16ClN3O4/c1-18(15(22)14-12(16)7-17-19(14)2)8-10-3-5-11(6-4-10)23-9-13(20)21/h3-7H,8-9H2,1-2H3,(H,20,21) |
| InChIKey | UEBFXQHJJIKYDK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |