C17H24FNO3 — CID 136552349
2-[3-[(4-fluorophenyl)methyl]-3-hydroxypyrrolidin-1-yl]-4-methylpentanoic acid (PubChem CID 136552349) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methyl]-3-hydroxypyrrolidin-1-yl]-4-methylpentanoic acid.
| Compound Name | 2-[3-[(4-fluorophenyl)methyl]-3-hydroxypyrrolidin-1-yl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 136552349 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methyl]-3-hydroxypyrrolidin-1-yl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N1CCC(O)(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H24FNO3/c1-12(2)9-15(16(20)21)19-8-7-17(22,11-19)10-13-3-5-14(18)6-4-13/h3-6,12,15,22H,7-11H2,1-2H3,(H,20,21) |
| InChIKey | IQGMEXRTUUTREM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |