C21H31N3O3 — CID 136552707
1-[3-[[methyl(pyridin-3-ylmethyl)amino]methyl]pyrrolidine-1-carbonyl]cycloheptane-1-carboxylic acid (PubChem CID 136552707) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-[3-[[methyl(pyridin-3-ylmethyl)amino]methyl]pyrrolidine-1-carbonyl]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[3-[[methyl(pyridin-3-ylmethyl)amino]methyl]pyrrolidine-1-carbonyl]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 136552707 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-[3-[[methyl(pyridin-3-ylmethyl)amino]methyl]pyrrolidine-1-carbonyl]cycloheptane-1-carboxylic acid |
| SMILES | CN(Cc1cccnc1)CC1CCN(C(=O)C2(C(=O)O)CCCCCC2)C1 |
| InChI | InChI=1S/C21H31N3O3/c1-23(14-17-7-6-11-22-13-17)15-18-8-12-24(16-18)19(25)21(20(26)27)9-4-2-3-5-10-21/h6-7,11,13,18H,2-5,8-10,12,14-16H2,1H3,(H,26,27) |
| InChIKey | KVEUGRQKQYWLTL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|