C16H21N3O4 — CID 136552711
1-(4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carbonyl)cycloheptane-1-carboxylic acid (PubChem CID 136552711) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-(4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carbonyl)cycloheptane-1-carboxylic acid.
| Compound Name | 1-(4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carbonyl)cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 136552711 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-(4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carbonyl)cycloheptane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)N2CCc3nc[nH]c(=O)c3C2)CCCCCC1 |
| InChI | InChI=1S/C16H21N3O4/c20-13-11-9-19(8-5-12(11)17-10-18-13)14(21)16(15(22)23)6-3-1-2-4-7-16/h10H,1-9H2,(H,22,23)(H,17,18,20) |
| InChIKey | SHQIATZWMLINPE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|