C22H24N4O2 — CID 136553770
3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl-[1-(3-methylphenyl)benzimidazol-5-yl]methanone (PubChem CID 136553770) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl-[1-(3-methylphenyl)benzimidazol-5-yl]methanone.
| Compound Name | 3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl-[1-(3-methylphenyl)benzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 136553770 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl-[1-(3-methylphenyl)benzimidazol-5-yl]methanone |
| SMILES | Cc1cccc(-n2cnc3cc(C(=O)N4CCN5CCOCC5C4)ccc32)c1 |
| InChI | InChI=1S/C22H24N4O2/c1-16-3-2-4-18(11-16)26-15-23-20-12-17(5-6-21(20)26)22(27)25-8-7-24-9-10-28-14-19(24)13-25/h2-6,11-12,15,19H,7-10,13-14H2,1H3 |
| InChIKey | YPKXBUSGRXXPDD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |