C19H20N4O — CID 136554180
5-[4-(4-methylphenoxy)piperidin-1-yl]pyrido[3,4-b]pyrazine (PubChem CID 136554180) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 5-[4-(4-methylphenoxy)piperidin-1-yl]pyrido[3,4-b]pyrazine.
| Compound Name | 5-[4-(4-methylphenoxy)piperidin-1-yl]pyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 136554180 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 5-[4-(4-methylphenoxy)piperidin-1-yl]pyrido[3,4-b]pyrazine |
| SMILES | Cc1ccc(OC2CCN(c3nccc4nccnc34)CC2)cc1 |
| InChI | InChI=1S/C19H20N4O/c1-14-2-4-15(5-3-14)24-16-7-12-23(13-8-16)19-18-17(6-9-22-19)20-10-11-21-18/h2-6,9-11,16H,7-8,12-13H2,1H3 |
| InChIKey | NAPPHULMCWPADD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |