C20H24F2N4O — CID 136554323
4-(aminomethyl)-N-[1-(2,4-difluorophenyl)cyclopentyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 136554323) has the molecular formula C20H24F2N4O and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[1-(2,4-difluorophenyl)cyclopentyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[1-(2,4-difluorophenyl)cyclopentyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 136554323 |
| Molecular Formula | C20H24F2N4O |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-(aminomethyl)-N-[1-(2,4-difluorophenyl)cyclopentyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | NCC1CCCn2ncc(C(=O)NC3(c4ccc(F)cc4F)CCCC3)c21 |
| InChI | InChI=1S/C20H24F2N4O/c21-14-5-6-16(17(22)10-14)20(7-1-2-8-20)25-19(27)15-12-24-26-9-3-4-13(11-23)18(15)26/h5-6,10,12-13H,1-4,7-9,11,23H2,(H,25,27) |
| InChIKey | DJMKEUQZNBWULN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |