C12H13N3O2 — CID 136554458
6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-3-yl-(3-ethynylazetidin-1-yl)methanone (PubChem CID 136554458) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-3-yl-(3-ethynylazetidin-1-yl)methanone.
| Compound Name | 6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-3-yl-(3-ethynylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 136554458 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-3-yl-(3-ethynylazetidin-1-yl)methanone |
| SMILES | C#CC1CN(C(=O)c2cnc3n2CCOC3)C1 |
| InChI | InChI=1S/C12H13N3O2/c1-2-9-6-14(7-9)12(16)10-5-13-11-8-17-4-3-15(10)11/h1,5,9H,3-4,6-8H2 |
| InChIKey | LQCWBXVFLFZXIB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|