C16H22N6 — CID 136554738
2-N-[(2-phenylcyclohexyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 136554738) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-N-[(2-phenylcyclohexyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(2-phenylcyclohexyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 136554738 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-N-[(2-phenylcyclohexyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(NCC2CCCCC2c2ccccc2)n1 |
| InChI | InChI=1S/C16H22N6/c17-14-20-15(18)22-16(21-14)19-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10H2,(H5,17,18,19,20,21,22) |
| InChIKey | SPZYQFSIRNMFCM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |