C19H22N6O3 — CID 136554810
3-methyl-1-[2-oxo-2-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 136554810) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-methyl-1-[2-oxo-2-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-methyl-1-[2-oxo-2-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 136554810 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-methyl-1-[2-oxo-2-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN(CC(=O)N2CCC(c3nc(-c4ccccc4)n[nH]3)CC2)C1=O |
| InChI | InChI=1S/C19H22N6O3/c1-23-15(26)11-25(19(23)28)12-16(27)24-9-7-14(8-10-24)18-20-17(21-22-18)13-5-3-2-4-6-13/h2-6,14H,7-12H2,1H3,(H,20,21,22) |
| InChIKey | VNKCKJYLCFICOU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|