C11H14F3N7O — CID 136555127
1-[(3-ethyltriazol-4-yl)methyl]-3-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]urea (PubChem CID 136555127) has the molecular formula C11H14F3N7O and a molecular weight of 317.28 g/mol. Its IUPAC name is 1-[(3-ethyltriazol-4-yl)methyl]-3-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]urea.
| Compound Name | 1-[(3-ethyltriazol-4-yl)methyl]-3-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 136555127 |
| Molecular Formula | C11H14F3N7O |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-[(3-ethyltriazol-4-yl)methyl]-3-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]urea |
| SMILES | CCn1nncc1CNC(=O)Nc1cc(C(F)(F)F)nn1C |
| InChI | InChI=1S/C11H14F3N7O/c1-3-21-7(6-16-19-21)5-15-10(22)17-9-4-8(11(12,13)14)18-20(9)2/h4,6H,3,5H2,1-2H3,(H2,15,17,22) |
| InChIKey | FKRDJYKUKVLINC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |