C14H17N3O3S — CID 136557082
3-[(4-methylphenoxy)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]thiazepine 7,7-dioxide (PubChem CID 136557082) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 3-[(4-methylphenoxy)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]thiazepine 7,7-dioxide.
| Compound Name | 3-[(4-methylphenoxy)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]thiazepine 7,7-dioxide |
|---|---|
| PubChem CID | 136557082 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[(4-methylphenoxy)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]thiazepine 7,7-dioxide |
| SMILES | Cc1ccc(OCc2nnc3n2CCS(=O)(=O)CC3)cc1 |
| InChI | InChI=1S/C14H17N3O3S/c1-11-2-4-12(5-3-11)20-10-14-16-15-13-6-8-21(18,19)9-7-17(13)14/h2-5H,6-10H2,1H3 |
| InChIKey | HACIIPMWDCOUEW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |