About 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol
2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol (PubChem CID 136557228) has the molecular formula C17H19N5OS
and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol |
| PubChem CID | 136557228 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(c2ncnc3c(-c4ccccc4)nsc23)CC1 |
| InChI | InChI=1S/C17H19N5OS/c23-11-10-21-6-8-22(9-7-21)17-16-15(18-12-19-17)14(20-24-16)13-4-2-1-3-5-13/h1-5,12,23H,6-11H2 |
| InChIKey | GORZUOYTIMMKAI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol?
The IUPAC name of 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol (CID 136557228) is 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol.
What is the SMILES notation for 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol?
The canonical SMILES for 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol is OCCN1CCN(c2ncnc3c(-c4ccccc4)nsc23)CC1.
What is the InChIKey of 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol?
The InChIKey is GORZUOYTIMMKAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5OS/c23-11-10-21-6-8-22(9-7-21)17-16-15(18-12-19-17)14(20-24-16)13-4-2-1-3-5-13/h1-5,12,23H,6-11H2.
What are the key properties of 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol?
2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol has a molecular weight of 341.44 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]ethanol is sourced from PubChem (CID 136557228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).