C16H21N3O — CID 136557293
6-(4-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-methylpyridine-3-carbonitrile (PubChem CID 136557293) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 6-(4-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-methylpyridine-3-carbonitrile.
| Compound Name | 6-(4-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 136557293 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 6-(4-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-methylpyridine-3-carbonitrile |
| SMILES | Cc1nc(N2CCC(O)C3CCCCC32)ccc1C#N |
| InChI | InChI=1S/C16H21N3O/c1-11-12(10-17)6-7-16(18-11)19-9-8-15(20)13-4-2-3-5-14(13)19/h6-7,13-15,20H,2-5,8-9H2,1H3 |
| InChIKey | WJLZKNWTFNEBKT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |