C12H12Cl2N2O3S — CID 136557762
2,4-dichloro-N-(2-hydroxypropyl)quinoline-3-sulfonamide (PubChem CID 136557762) has the molecular formula C12H12Cl2N2O3S and a molecular weight of 335.21 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-hydroxypropyl)quinoline-3-sulfonamide.
| Compound Name | 2,4-dichloro-N-(2-hydroxypropyl)quinoline-3-sulfonamide |
|---|---|
| PubChem CID | 136557762 |
| Molecular Formula | C12H12Cl2N2O3S |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 2,4-dichloro-N-(2-hydroxypropyl)quinoline-3-sulfonamide |
| SMILES | CC(O)CNS(=O)(=O)c1c(Cl)nc2ccccc2c1Cl |
| InChI | InChI=1S/C12H12Cl2N2O3S/c1-7(17)6-15-20(18,19)11-10(13)8-4-2-3-5-9(8)16-12(11)14/h2-5,7,15,17H,6H2,1H3 |
| InChIKey | VJRNPDDPRLQFIZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|