About 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate
2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate (PubChem CID 136558265) has the molecular formula C10H12FN3O3
and a molecular weight of 241.22 g/mol. Its IUPAC name is 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate |
| PubChem CID | 136558265 |
| Molecular Formula | C10H12FN3O3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate |
| SMILES | Cc1nc2c(c(=O)[nH]1)CN(C(=O)OCCF)C2 |
| InChI | InChI=1S/C10H12FN3O3/c1-6-12-8-5-14(10(16)17-3-2-11)4-7(8)9(15)13-6/h2-5H2,1H3,(H,12,13,15) |
| InChIKey | XIHMSUJWAUJHAU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate?
The IUPAC name of 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate (CID 136558265) is 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate.
What is the SMILES notation for 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate?
The canonical SMILES for 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate is Cc1nc2c(c(=O)[nH]1)CN(C(=O)OCCF)C2.
What is the InChIKey of 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate?
The InChIKey is XIHMSUJWAUJHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN3O3/c1-6-12-8-5-14(10(16)17-3-2-11)4-7(8)9(15)13-6/h2-5H2,1H3,(H,12,13,15).
What are the key properties of 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate?
2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate has a molecular weight of 241.22 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 2-methyl-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 136558265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).