C18H18N6O — CID 136558756
(2-pyrimidin-2-ylpiperidin-1-yl)-[4-(triazol-1-yl)phenyl]methanone (PubChem CID 136558756) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is (2-pyrimidin-2-ylpiperidin-1-yl)-[4-(triazol-1-yl)phenyl]methanone.
| Compound Name | (2-pyrimidin-2-ylpiperidin-1-yl)-[4-(triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 136558756 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (2-pyrimidin-2-ylpiperidin-1-yl)-[4-(triazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-n2ccnn2)cc1)N1CCCCC1c1ncccn1 |
| InChI | InChI=1S/C18H18N6O/c25-18(14-5-7-15(8-6-14)24-13-11-21-22-24)23-12-2-1-4-16(23)17-19-9-3-10-20-17/h3,5-11,13,16H,1-2,4,12H2 |
| InChIKey | SEKAEBAUEIFTPE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |