About [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone
[2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone (PubChem CID 136559553) has the molecular formula C15H23N3OS
and a molecular weight of 293.44 g/mol. Its IUPAC name is [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone.
Molecular Properties
| Compound Name | [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone |
| PubChem CID | 136559553 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone |
| SMILES | Cc1nc(C2CCCN2C(=O)C2CCCSC2)[nH]c1C |
| InChI | InChI=1S/C15H23N3OS/c1-10-11(2)17-14(16-10)13-6-3-7-18(13)15(19)12-5-4-8-20-9-12/h12-13H,3-9H2,1-2H3,(H,16,17) |
| InChIKey | ZJARNASJJXEGDM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone?
The IUPAC name of [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone (CID 136559553) is [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone.
What is the SMILES notation for [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone?
The canonical SMILES for [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone is Cc1nc(C2CCCN2C(=O)C2CCCSC2)[nH]c1C.
What is the InChIKey of [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone?
The InChIKey is ZJARNASJJXEGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3OS/c1-10-11(2)17-14(16-10)13-6-3-7-18(13)15(19)12-5-4-8-20-9-12/h12-13H,3-9H2,1-2H3,(H,16,17).
What are the key properties of [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone?
[2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone has a molecular weight of 293.44 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,5-dimethyl-1H-imidazol-2-yl)pyrrolidin-1-yl]-(thian-3-yl)methanone is sourced from PubChem (CID 136559553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).