C17H27N3O2 — CID 136560226
4-ethoxy-1-spiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,1'-cyclohexane]-5-ylbutan-1-one (PubChem CID 136560226) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-ethoxy-1-spiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,1'-cyclohexane]-5-ylbutan-1-one.
| Compound Name | 4-ethoxy-1-spiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,1'-cyclohexane]-5-ylbutan-1-one |
|---|---|
| PubChem CID | 136560226 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 4-ethoxy-1-spiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,1'-cyclohexane]-5-ylbutan-1-one |
| SMILES | CCOCCCC(=O)N1CCc2[nH]cnc2C12CCCCC2 |
| InChI | InChI=1S/C17H27N3O2/c1-2-22-12-6-7-15(21)20-11-8-14-16(19-13-18-14)17(20)9-4-3-5-10-17/h13H,2-12H2,1H3,(H,18,19) |
| InChIKey | GTAHXXKUFVNRLO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|