C15H18BrN3O — CID 136560284
1-[3-(5-bromopyrimidin-2-yl)piperidin-1-yl]-2-cyclobutylideneethanone (PubChem CID 136560284) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is 1-[3-(5-bromopyrimidin-2-yl)piperidin-1-yl]-2-cyclobutylideneethanone.
| Compound Name | 1-[3-(5-bromopyrimidin-2-yl)piperidin-1-yl]-2-cyclobutylideneethanone |
|---|---|
| PubChem CID | 136560284 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 1-[3-(5-bromopyrimidin-2-yl)piperidin-1-yl]-2-cyclobutylideneethanone |
| SMILES | O=C(C=C1CCC1)N1CCCC(c2ncc(Br)cn2)C1 |
| InChI | InChI=1S/C15H18BrN3O/c16-13-8-17-15(18-9-13)12-5-2-6-19(10-12)14(20)7-11-3-1-4-11/h7-9,12H,1-6,10H2 |
| InChIKey | XUSIRMSUBCUOFS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|