About 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide
3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide (PubChem CID 136560350) has the molecular formula C11H16F3N3O2
and a molecular weight of 279.26 g/mol. Its IUPAC name is 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide.
Molecular Properties
| Compound Name | 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide |
| PubChem CID | 136560350 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide |
| SMILES | COCC(C)(C)C(=O)NCc1ncc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C11H16F3N3O2/c1-10(2,6-19-3)9(18)16-5-8-15-4-7(17-8)11(12,13)14/h4H,5-6H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | AIJWLAYJBZZYRE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide?
The IUPAC name of 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide (CID 136560350) is 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide.
What is the SMILES notation for 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide?
The canonical SMILES for 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide is COCC(C)(C)C(=O)NCc1ncc(C(F)(F)F)[nH]1.
What is the InChIKey of 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide?
The InChIKey is AIJWLAYJBZZYRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3O2/c1-10(2,6-19-3)9(18)16-5-8-15-4-7(17-8)11(12,13)14/h4H,5-6H2,1-3H3,(H,15,17)(H,16,18).
What are the key properties of 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide?
3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide has a molecular weight of 279.26 g/mol, XLogP of 1.72, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,2-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]propanamide is sourced from PubChem (CID 136560350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).