C17H28N2O4 — CID 136560668
3-(4-butan-2-yloxyphenyl)-1-(2,2-dimethoxyethyl)-1-ethylurea (PubChem CID 136560668) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 3-(4-butan-2-yloxyphenyl)-1-(2,2-dimethoxyethyl)-1-ethylurea.
| Compound Name | 3-(4-butan-2-yloxyphenyl)-1-(2,2-dimethoxyethyl)-1-ethylurea |
|---|---|
| PubChem CID | 136560668 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 3-(4-butan-2-yloxyphenyl)-1-(2,2-dimethoxyethyl)-1-ethylurea |
| SMILES | CCC(C)Oc1ccc(NC(=O)N(CC)CC(OC)OC)cc1 |
| InChI | InChI=1S/C17H28N2O4/c1-6-13(3)23-15-10-8-14(9-11-15)18-17(20)19(7-2)12-16(21-4)22-5/h8-11,13,16H,6-7,12H2,1-5H3,(H,18,20) |
| InChIKey | RBRZEKAUUMDJIA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|