C10H11ClN4O5S — CID 136560883
N-(2-chloro-4-nitrophenyl)-3-sulfamoylazetidine-1-carboxamide (PubChem CID 136560883) has the molecular formula C10H11ClN4O5S and a molecular weight of 334.74 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-3-sulfamoylazetidine-1-carboxamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-3-sulfamoylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 136560883 |
| Molecular Formula | C10H11ClN4O5S |
| Molecular Weight | 334.74 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-3-sulfamoylazetidine-1-carboxamide |
| SMILES | NS(=O)(=O)C1CN(C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C10H11ClN4O5S/c11-8-3-6(15(17)18)1-2-9(8)13-10(16)14-4-7(5-14)21(12,19)20/h1-3,7H,4-5H2,(H,13,16)(H2,12,19,20) |
| InChIKey | LETAITSHSRRTOX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.74 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|