C14H17N5O2 — CID 136561939
6-methyl-5-nitro-N-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylmethyl)pyridin-2-amine (PubChem CID 136561939) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 6-methyl-5-nitro-N-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylmethyl)pyridin-2-amine.
| Compound Name | 6-methyl-5-nitro-N-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 136561939 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 6-methyl-5-nitro-N-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylmethyl)pyridin-2-amine |
| SMILES | Cc1nc(NCc2nc3c([nH]2)CCCC3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N5O2/c1-9-12(19(20)21)6-7-13(16-9)15-8-14-17-10-4-2-3-5-11(10)18-14/h6-7H,2-5,8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | IWGYDHPKPTWTPF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|