C15H23F3N4O2 — CID 136561977
N'-methyl-N-[6-(oxan-4-yloxy)pyrimidin-4-yl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine (PubChem CID 136561977) has the molecular formula C15H23F3N4O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is N'-methyl-N-[6-(oxan-4-yloxy)pyrimidin-4-yl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine.
| Compound Name | N'-methyl-N-[6-(oxan-4-yloxy)pyrimidin-4-yl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 136561977 |
| Molecular Formula | C15H23F3N4O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N'-methyl-N-[6-(oxan-4-yloxy)pyrimidin-4-yl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
| SMILES | CN(CCCNc1cc(OC2CCOCC2)ncn1)CC(F)(F)F |
| InChI | InChI=1S/C15H23F3N4O2/c1-22(10-15(16,17)18)6-2-5-19-13-9-14(21-11-20-13)24-12-3-7-23-8-4-12/h9,11-12H,2-8,10H2,1H3,(H,19,20,21) |
| InChIKey | CKWPUKUGBCJWNV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|