C18H21N5O2 — CID 136562635
2-(3-methyl-1,2,4-oxadiazol-5-yl)-1-phenyl-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-ylmethyl)ethanamine (PubChem CID 136562635) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-(3-methyl-1,2,4-oxadiazol-5-yl)-1-phenyl-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-ylmethyl)ethanamine.
| Compound Name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)-1-phenyl-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 136562635 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)-1-phenyl-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-ylmethyl)ethanamine |
| SMILES | Cc1noc(CC(NCc2n[nH]c3c2COCC3)c2ccccc2)n1 |
| InChI | InChI=1S/C18H21N5O2/c1-12-20-18(25-23-12)9-16(13-5-3-2-4-6-13)19-10-17-14-11-24-8-7-15(14)21-22-17/h2-6,16,19H,7-11H2,1H3,(H,21,22) |
| InChIKey | QYRCOPOIIBQOEK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |