C17H29N5O — CID 136562716
N,2-dimethyl-N-(1-propylpiperidin-4-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide (PubChem CID 136562716) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is N,2-dimethyl-N-(1-propylpiperidin-4-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide.
| Compound Name | N,2-dimethyl-N-(1-propylpiperidin-4-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 136562716 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | N,2-dimethyl-N-(1-propylpiperidin-4-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
| SMILES | CCCN1CCC(N(C)C(=O)C2CCc3nc(C)nn3C2)CC1 |
| InChI | InChI=1S/C17H29N5O/c1-4-9-21-10-7-15(8-11-21)20(3)17(23)14-5-6-16-18-13(2)19-22(16)12-14/h14-15H,4-12H2,1-3H3 |
| InChIKey | XWRNDTRCPMWDLF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |