C17H28N4O2 — CID 136562977
1-(2,2-dimethylmorpholin-4-yl)-2-(7,7-dimethyl-1,4,6,8-tetrahydropyrazolo[4,5-c]azepin-5-yl)ethanone (PubChem CID 136562977) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-(2,2-dimethylmorpholin-4-yl)-2-(7,7-dimethyl-1,4,6,8-tetrahydropyrazolo[4,5-c]azepin-5-yl)ethanone.
| Compound Name | 1-(2,2-dimethylmorpholin-4-yl)-2-(7,7-dimethyl-1,4,6,8-tetrahydropyrazolo[4,5-c]azepin-5-yl)ethanone |
|---|---|
| PubChem CID | 136562977 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-(2,2-dimethylmorpholin-4-yl)-2-(7,7-dimethyl-1,4,6,8-tetrahydropyrazolo[4,5-c]azepin-5-yl)ethanone |
| SMILES | CC1(C)Cc2[nH]ncc2CN(CC(=O)N2CCOC(C)(C)C2)C1 |
| InChI | InChI=1S/C17H28N4O2/c1-16(2)7-14-13(8-18-19-14)9-20(11-16)10-15(22)21-5-6-23-17(3,4)12-21/h8H,5-7,9-12H2,1-4H3,(H,18,19) |
| InChIKey | OLHFKRIKJWZTLV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |