C16H17F2N3O2 — CID 136563193
N-(3,5-difluorophenyl)-2-[4-(1,3-oxazol-2-yl)piperidin-1-yl]acetamide (PubChem CID 136563193) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-[4-(1,3-oxazol-2-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(3,5-difluorophenyl)-2-[4-(1,3-oxazol-2-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 136563193 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-[4-(1,3-oxazol-2-yl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(c2ncco2)CC1)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H17F2N3O2/c17-12-7-13(18)9-14(8-12)20-15(22)10-21-4-1-11(2-5-21)16-19-3-6-23-16/h3,6-9,11H,1-2,4-5,10H2,(H,20,22) |
| InChIKey | NGMWSFWBNOLDHC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |