About 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole
4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole (PubChem CID 136563410) has the molecular formula C17H26N4O
and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole |
| PubChem CID | 136563410 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole |
| SMILES | CCc1onc(C)c1CN1CCC(c2nc(C)c(C)[nH]2)CC1 |
| InChI | InChI=1S/C17H26N4O/c1-5-16-15(13(4)20-22-16)10-21-8-6-14(7-9-21)17-18-11(2)12(3)19-17/h14H,5-10H2,1-4H3,(H,18,19) |
| InChIKey | JEXVPUXZKOYSLM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole?
The IUPAC name of 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole (CID 136563410) is 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole.
What is the SMILES notation for 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole?
The canonical SMILES for 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole is CCc1onc(C)c1CN1CCC(c2nc(C)c(C)[nH]2)CC1.
What is the InChIKey of 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole?
The InChIKey is JEXVPUXZKOYSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O/c1-5-16-15(13(4)20-22-16)10-21-8-6-14(7-9-21)17-18-11(2)12(3)19-17/h14H,5-10H2,1-4H3,(H,18,19).
What are the key properties of 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole?
4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole has a molecular weight of 302.42 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]methyl]-5-ethyl-3-methyl-1,2-oxazole is sourced from PubChem (CID 136563410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).