C16H22N2O4S — CID 136563445
1-(2-phenyloxolane-2-carbonyl)piperidine-4-sulfonamide (PubChem CID 136563445) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-(2-phenyloxolane-2-carbonyl)piperidine-4-sulfonamide.
| Compound Name | 1-(2-phenyloxolane-2-carbonyl)piperidine-4-sulfonamide |
|---|---|
| PubChem CID | 136563445 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-(2-phenyloxolane-2-carbonyl)piperidine-4-sulfonamide |
| SMILES | NS(=O)(=O)C1CCN(C(=O)C2(c3ccccc3)CCCO2)CC1 |
| InChI | InChI=1S/C16H22N2O4S/c17-23(20,21)14-7-10-18(11-8-14)15(19)16(9-4-12-22-16)13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2,(H2,17,20,21) |
| InChIKey | VYHAXGCVRSAAMD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |