C16H19N7O — CID 136563655
4-(1H-indol-2-yl)-N-(2-methyltetrazol-5-yl)piperidine-1-carboxamide (PubChem CID 136563655) has the molecular formula C16H19N7O and a molecular weight of 325.38 g/mol. Its IUPAC name is 4-(1H-indol-2-yl)-N-(2-methyltetrazol-5-yl)piperidine-1-carboxamide.
| Compound Name | 4-(1H-indol-2-yl)-N-(2-methyltetrazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 136563655 |
| Molecular Formula | C16H19N7O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-(1H-indol-2-yl)-N-(2-methyltetrazol-5-yl)piperidine-1-carboxamide |
| SMILES | Cn1nnc(NC(=O)N2CCC(c3cc4ccccc4[nH]3)CC2)n1 |
| InChI | InChI=1S/C16H19N7O/c1-22-20-15(19-21-22)18-16(24)23-8-6-11(7-9-23)14-10-12-4-2-3-5-13(12)17-14/h2-5,10-11,17H,6-9H2,1H3,(H,18,20,24) |
| InChIKey | WPFOHSOECUATGD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |