C14H14F3N3O2 — CID 136563984
N-(1H-imidazol-5-ylmethyl)-2-methoxy-2-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 136563984) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-2-methoxy-2-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-2-methoxy-2-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 136563984 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-2-methoxy-2-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | COC(C(=O)NCc1cnc[nH]1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O2/c1-22-12(13(21)19-7-9-6-18-8-20-9)10-4-2-3-5-11(10)14(15,16)17/h2-6,8,12H,7H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | UZYKMTIPAWGPLP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |