C16H23F3N4O — CID 136564061
3-(1-methylpyrazol-4-yl)-N-[1-(trifluoromethyl)cyclohexyl]pyrrolidine-1-carboxamide (PubChem CID 136564061) has the molecular formula C16H23F3N4O and a molecular weight of 344.38 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)-N-[1-(trifluoromethyl)cyclohexyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-(1-methylpyrazol-4-yl)-N-[1-(trifluoromethyl)cyclohexyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 136564061 |
| Molecular Formula | C16H23F3N4O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)-N-[1-(trifluoromethyl)cyclohexyl]pyrrolidine-1-carboxamide |
| SMILES | Cn1cc(C2CCN(C(=O)NC3(C(F)(F)F)CCCCC3)C2)cn1 |
| InChI | InChI=1S/C16H23F3N4O/c1-22-10-13(9-20-22)12-5-8-23(11-12)14(24)21-15(16(17,18)19)6-3-2-4-7-15/h9-10,12H,2-8,11H2,1H3,(H,21,24) |
| InChIKey | QMRNWRYAJNCHCH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |