C12H16F2N4O3S — CID 136565493
(3,3-difluoropiperidin-1-yl)-(2-methyl-1,1-dioxo-3,4-dihydropyrazolo[1,5-e][1,2,5]thiadiazin-7-yl)methanone (PubChem CID 136565493) has the molecular formula C12H16F2N4O3S and a molecular weight of 334.35 g/mol. Its IUPAC name is (3,3-difluoropiperidin-1-yl)-(2-methyl-1,1-dioxo-3,4-dihydropyrazolo[1,5-e][1,2,5]thiadiazin-7-yl)methanone.
| Compound Name | (3,3-difluoropiperidin-1-yl)-(2-methyl-1,1-dioxo-3,4-dihydropyrazolo[1,5-e][1,2,5]thiadiazin-7-yl)methanone |
|---|---|
| PubChem CID | 136565493 |
| Molecular Formula | C12H16F2N4O3S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (3,3-difluoropiperidin-1-yl)-(2-methyl-1,1-dioxo-3,4-dihydropyrazolo[1,5-e][1,2,5]thiadiazin-7-yl)methanone |
| SMILES | CN1CCn2nc(C(=O)N3CCCC(F)(F)C3)cc2S1(=O)=O |
| InChI | InChI=1S/C12H16F2N4O3S/c1-16-5-6-18-10(22(16,20)21)7-9(15-18)11(19)17-4-2-3-12(13,14)8-17/h7H,2-6,8H2,1H3 |
| InChIKey | HQYXNSQQNRNFJZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |