About 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone
1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone (PubChem CID 136565712) has the molecular formula C16H19ClN4O
and a molecular weight of 318.81 g/mol. Its IUPAC name is 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone |
| PubChem CID | 136565712 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone |
| SMILES | CCn1cc(CC(=O)N2CCc3ccc(Cl)c(C)c3C2)nn1 |
| InChI | InChI=1S/C16H19ClN4O/c1-3-21-9-13(18-19-21)8-16(22)20-7-6-12-4-5-15(17)11(2)14(12)10-20/h4-5,9H,3,6-8,10H2,1-2H3 |
| InChIKey | SHOFEDDYTHNMBM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone?
The IUPAC name of 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone (CID 136565712) is 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone.
What is the SMILES notation for 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone?
The canonical SMILES for 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone is CCn1cc(CC(=O)N2CCc3ccc(Cl)c(C)c3C2)nn1.
What is the InChIKey of 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone?
The InChIKey is SHOFEDDYTHNMBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN4O/c1-3-21-9-13(18-19-21)8-16(22)20-7-6-12-4-5-15(17)11(2)14(12)10-20/h4-5,9H,3,6-8,10H2,1-2H3.
What are the key properties of 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone?
1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone has a molecular weight of 318.81 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-chloro-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-ethyltriazol-4-yl)ethanone is sourced from PubChem (CID 136565712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).