C20H23N3O2 — CID 136566907
3-(4,4-dimethyl-3-phenylpiperidine-1-carbonyl)pyridine-2-carboxamide (PubChem CID 136566907) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-(4,4-dimethyl-3-phenylpiperidine-1-carbonyl)pyridine-2-carboxamide.
| Compound Name | 3-(4,4-dimethyl-3-phenylpiperidine-1-carbonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 136566907 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-(4,4-dimethyl-3-phenylpiperidine-1-carbonyl)pyridine-2-carboxamide |
| SMILES | CC1(C)CCN(C(=O)c2cccnc2C(N)=O)CC1c1ccccc1 |
| InChI | InChI=1S/C20H23N3O2/c1-20(2)10-12-23(13-16(20)14-7-4-3-5-8-14)19(25)15-9-6-11-22-17(15)18(21)24/h3-9,11,16H,10,12-13H2,1-2H3,(H2,21,24) |
| InChIKey | WYQLKUYADUHFTJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |