C42H36ClN5O6 — CID 136568744
1-[(2Z)-2-[(E)-3-[5-(1,3-benzoxazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1-phenylbenzimidazol-5-yl]ethanone perchlorate (PubChem CID 136568744) has the molecular formula C42H36ClN5O6 and a molecular weight of 742.23 g/mol. Its IUPAC name is 1-[(2Z)-2-[(E)-3-[5-(1,3-benzoxazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1-phenylbenzimidazol-5-yl]ethanone perchlorate.
| Compound Name | 1-[(2Z)-2-[(E)-3-[5-(1,3-benzoxazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1-phenylbenzimidazol-5-yl]ethanone perchlorate |
|---|---|
| PubChem CID | 136568744 |
| Molecular Formula | C42H36ClN5O6 |
| Molecular Weight | 742.23 g/mol |
| Exact Mass | 741.24 |
| IUPAC Name | 1-[(2Z)-2-[(E)-3-[5-(1,3-benzoxazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1-phenylbenzimidazol-5-yl]ethanone perchlorate |
| SMILES | CCN1/C(=C/C=C/c2n(-c3ccccc3)c3ccc(-c4nc5ccccc5o4)cc3[n+]2CC)N(c2ccccc2)c2ccc(C(C)=O)cc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C42H36N5O2.ClHO4/c1-4-44-37-27-30(29(3)48)23-25-35(37)46(32-15-8-6-9-16-32)40(44)21-14-22-41-45(5-2)38-28-31(42-43-34-19-12-13-20-39(34)49-42)24-26-36(38)47(41)33-17-10-7-11-18-33;2-1(3,4)5/h6-28H,4-5H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | MPAAAZKBVRIZHU-UHFFFAOYSA-M |
| XLogP | 4.73 |
| TPSA | 150.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.23 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|