About 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide
4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide (PubChem CID 136569394) has the molecular formula C17H24N6O2
and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide.
Molecular Properties
| Compound Name | 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide |
| PubChem CID | 136569394 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide |
| SMILES | CCC1CN(c2nnnn2Cc2ccc(C(N)=O)cc2)CC(CC)O1 |
| InChI | InChI=1S/C17H24N6O2/c1-3-14-10-22(11-15(4-2)25-14)17-19-20-21-23(17)9-12-5-7-13(8-6-12)16(18)24/h5-8,14-15H,3-4,9-11H2,1-2H3,(H2,18,24) |
| InChIKey | CXAYEMMQLABRCB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide?
The IUPAC name of 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide (CID 136569394) is 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide.
What is the SMILES notation for 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide?
The canonical SMILES for 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide is CCC1CN(c2nnnn2Cc2ccc(C(N)=O)cc2)CC(CC)O1.
What is the InChIKey of 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide?
The InChIKey is CXAYEMMQLABRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N6O2/c1-3-14-10-22(11-15(4-2)25-14)17-19-20-21-23(17)9-12-5-7-13(8-6-12)16(18)24/h5-8,14-15H,3-4,9-11H2,1-2H3,(H2,18,24).
What are the key properties of 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide?
4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide has a molecular weight of 344.42 g/mol, XLogP of 1.21, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-(2,6-diethylmorpholin-4-yl)tetrazol-1-yl]methyl]benzamide is sourced from PubChem (CID 136569394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).