About 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine
5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine (PubChem CID 136570479) has the molecular formula C16H16N4O
and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine.
Molecular Properties
| Compound Name | 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine |
| PubChem CID | 136570479 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine |
| SMILES | Cn1ncc2ncc(-c3cccc4c3CC(N)CO4)cc21 |
| InChI | InChI=1S/C16H16N4O/c1-20-15-5-10(7-18-14(15)8-19-20)12-3-2-4-16-13(12)6-11(17)9-21-16/h2-5,7-8,11H,6,9,17H2,1H3 |
| InChIKey | OQOMGGBAEPOVAM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine?
The IUPAC name of 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine (CID 136570479) is 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine.
What is the SMILES notation for 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine?
The canonical SMILES for 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine is Cn1ncc2ncc(-c3cccc4c3CC(N)CO4)cc21.
What is the InChIKey of 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine?
The InChIKey is OQOMGGBAEPOVAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O/c1-20-15-5-10(7-18-14(15)8-19-20)12-3-2-4-16-13(12)6-11(17)9-21-16/h2-5,7-8,11H,6,9,17H2,1H3.
What are the key properties of 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine?
5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine has a molecular weight of 280.33 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methylpyrazolo[4,5-b]pyridin-6-yl)-3,4-dihydro-2H-chromen-3-amine is sourced from PubChem (CID 136570479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).