C11H18N4O2S — CID 136571585
[8-(3-methyl-1,2,4-thiadiazol-5-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol (PubChem CID 136571585) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is [8-(3-methyl-1,2,4-thiadiazol-5-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol.
| Compound Name | [8-(3-methyl-1,2,4-thiadiazol-5-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol |
|---|---|
| PubChem CID | 136571585 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [8-(3-methyl-1,2,4-thiadiazol-5-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol |
| SMILES | Cc1nsc(N2CCN3CCOCC3(CO)C2)n1 |
| InChI | InChI=1S/C11H18N4O2S/c1-9-12-10(18-13-9)14-2-3-15-4-5-17-8-11(15,6-14)7-16/h16H,2-8H2,1H3 |
| InChIKey | JQZNEBWRLCUMJI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |