About 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea
1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea (PubChem CID 136571757) has the molecular formula C12H17N3O4
and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea |
| PubChem CID | 136571757 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea |
| SMILES | Cc1nocc1NC(=O)NC1C(=O)OCCC1(C)C |
| InChI | InChI=1S/C12H17N3O4/c1-7-8(6-19-15-7)13-11(17)14-9-10(16)18-5-4-12(9,2)3/h6,9H,4-5H2,1-3H3,(H2,13,14,17) |
| InChIKey | YDBWLGCDPGSTOT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea?
The IUPAC name of 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea (CID 136571757) is 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea.
What is the SMILES notation for 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea?
The canonical SMILES for 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea is Cc1nocc1NC(=O)NC1C(=O)OCCC1(C)C.
What is the InChIKey of 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea?
The InChIKey is YDBWLGCDPGSTOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4/c1-7-8(6-19-15-7)13-11(17)14-9-10(16)18-5-4-12(9,2)3/h6,9H,4-5H2,1-3H3,(H2,13,14,17).
What are the key properties of 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea?
1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea has a molecular weight of 267.28 g/mol, XLogP of 1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethyl-2-oxooxan-3-yl)-3-(3-methyl-1,2-oxazol-4-yl)urea is sourced from PubChem (CID 136571757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).