About 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine
2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine (PubChem CID 136571886) has the molecular formula C19H27NO3S
and a molecular weight of 349.50 g/mol. Its IUPAC name is 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine.
Molecular Properties
| Compound Name | 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine |
| PubChem CID | 136571886 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine |
| SMILES | O=S1(=O)CC2(CCC(NC(c3ccccc3)C3CCCO3)CC2)C1 |
| InChI | InChI=1S/C19H27NO3S/c21-24(22)13-19(14-24)10-8-16(9-11-19)20-18(17-7-4-12-23-17)15-5-2-1-3-6-15/h1-3,5-6,16-18,20H,4,7-14H2 |
| InChIKey | HJSHQUZSIXWDTP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine?
The IUPAC name of 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine (CID 136571886) is 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine.
What is the SMILES notation for 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine?
The canonical SMILES for 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine is O=S1(=O)CC2(CCC(NC(c3ccccc3)C3CCCO3)CC2)C1.
What is the InChIKey of 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine?
The InChIKey is HJSHQUZSIXWDTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO3S/c21-24(22)13-19(14-24)10-8-16(9-11-19)20-18(17-7-4-12-23-17)15-5-2-1-3-6-15/h1-3,5-6,16-18,20H,4,7-14H2.
What are the key properties of 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine?
2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine has a molecular weight of 349.50 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dioxo-N-[oxolan-2-yl(phenyl)methyl]-2λ6-thiaspiro[3.5]nonan-7-amine is sourced from PubChem (CID 136571886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).