About N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide
N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 136571949) has the molecular formula C17H15F3N2O2
and a molecular weight of 336.31 g/mol. Its IUPAC name is N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| PubChem CID | 136571949 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | O=C(NC1CCOCC1)c1ccc(-c2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C17H15F3N2O2/c18-13-3-2-12(15(19)16(13)20)10-1-4-14(21-9-10)17(23)22-11-5-7-24-8-6-11/h1-4,9,11H,5-8H2,(H,22,23) |
| InChIKey | XVPZWZBXNOVXQX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide?
The IUPAC name of N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (CID 136571949) is N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
What is the SMILES notation for N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide?
The canonical SMILES for N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide is O=C(NC1CCOCC1)c1ccc(-c2ccc(F)c(F)c2F)cn1.
What is the InChIKey of N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide?
The InChIKey is XVPZWZBXNOVXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N2O2/c18-13-3-2-12(15(19)16(13)20)10-1-4-14(21-9-10)17(23)22-11-5-7-24-8-6-11/h1-4,9,11H,5-8H2,(H,22,23).
What are the key properties of N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide?
N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide has a molecular weight of 336.31 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxan-4-yl)-5-(2,3,4-trifluorophenyl)pyridine-2-carboxamide is sourced from PubChem (CID 136571949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).